C40H64O2 — CID 163128786
(4,4,6a,6b,8a,11,11,14b-octamethyl-1,2,3,4a,5,6,6a,7,8,9,10,13,14,14a-tetradecahydropicen-3-yl) 3,6-dimethylocta-3,6-dienoate (PubChem CID 163128786) has the molecular formula C40H64O2 and a molecular weight of 576.95 g/mol. Its IUPAC name is (4,4,6a,6b,8a,11,11,14b-octamethyl-1,2,3,4a,5,6,6a,7,8,9,10,13,14,14a-tetradecahydropicen-3-yl) 3,6-dimethylocta-3,6-dienoate.
| Compound Name | (4,4,6a,6b,8a,11,11,14b-octamethyl-1,2,3,4a,5,6,6a,7,8,9,10,13,14,14a-tetradecahydropicen-3-yl) 3,6-dimethylocta-3,6-dienoate |
|---|---|
| PubChem CID | 163128786 |
| Molecular Formula | C40H64O2 |
| Molecular Weight | 576.95 g/mol |
| Exact Mass | 576.49 |
| IUPAC Name | (4,4,6a,6b,8a,11,11,14b-octamethyl-1,2,3,4a,5,6,6a,7,8,9,10,13,14,14a-tetradecahydropicen-3-yl) 3,6-dimethylocta-3,6-dienoate |
| SMILES | CC=C(C)CC=C(C)CC(=O)OC1CCC2(C)C(CCC3(C)C2CCC2C4=CC(C)(C)CCC4(C)CCC23C)C1(C)C |
| InChI | InChI=1S/C40H64O2/c1-12-27(2)13-14-28(3)25-34(41)42-33-18-19-38(9)31(36(33,6)7)17-20-40(11)32(38)16-15-29-30-26-35(4,5)21-22-37(30,8)23-24-39(29,40)10/h12,14,26,29,31-33H,13,15-25H2,1-11H3 |
| InChIKey | FIFRCGVXRWQWJW-UHFFFAOYSA-N |
| XLogP | 11.41 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.95 |
| LogP ≤ 5 | 11.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|