C20H32O2 — CID 10913743
(4aS,4bR,8R,9R,10aR)-2-ethenyl-8-(hydroxymethyl)-1,4b,8-trimethyl-3,4,4a,5,6,7,8a,9,10,10a-decahydrophenanthren-9-ol (PubChem CID 10913743) has the molecular formula C20H32O2 and a molecular weight of 304.47 g/mol. Its IUPAC name is (4aS,4bR,8R,9R,10aR)-2-ethenyl-8-(hydroxymethyl)-1,4b,8-trimethyl-3,4,4a,5,6,7,8a,9,10,10a-decahydrophenanthren-9-ol.
| Compound Name | (4aS,4bR,8R,9R,10aR)-2-ethenyl-8-(hydroxymethyl)-1,4b,8-trimethyl-3,4,4a,5,6,7,8a,9,10,10a-decahydrophenanthren-9-ol |
|---|---|
| PubChem CID | 10913743 |
| Molecular Formula | C20H32O2 |
| Molecular Weight | 304.47 g/mol |
| Exact Mass | 304.24 |
| IUPAC Name | (4aS,4bR,8R,9R,10aR)-2-ethenyl-8-(hydroxymethyl)-1,4b,8-trimethyl-3,4,4a,5,6,7,8a,9,10,10a-decahydrophenanthren-9-ol |
| SMILES | C=CC1=C(C)[C@@H]2CC(O)C3[C@](C)(CO)CCC[C@]3(C)[C@H]2CC1 |
| InChI | InChI=1S/C20H32O2/c1-5-14-7-8-16-15(13(14)2)11-17(22)18-19(3,12-21)9-6-10-20(16,18)4/h5,15-18,21-22H,1,6-12H2,2-4H3/t15-,16-,17?,18?,19-,20+/m0/s1 |
| InChIKey | BRNVYJSCDJWVGQ-WQMIYZMPSA-N |
| XLogP | 4.08 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.47 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |