C24H34O6 — CID 102192556
(1S,5R,9R,11S,13S)-11-acetyloxy-5-(acetyloxymethyl)-5,9-dimethyltetracyclo[11.2.1.01,10.04,9]hexadec-14-ene-14-carboxylic acid (PubChem CID 102192556) has the molecular formula C24H34O6 and a molecular weight of 418.53 g/mol. Its IUPAC name is (1S,5R,9R,11S,13S)-11-acetyloxy-5-(acetyloxymethyl)-5,9-dimethyltetracyclo[11.2.1.01,10.04,9]hexadec-14-ene-14-carboxylic acid.
| Compound Name | (1S,5R,9R,11S,13S)-11-acetyloxy-5-(acetyloxymethyl)-5,9-dimethyltetracyclo[11.2.1.01,10.04,9]hexadec-14-ene-14-carboxylic acid |
|---|---|
| PubChem CID | 102192556 |
| Molecular Formula | C24H34O6 |
| Molecular Weight | 418.53 g/mol |
| Exact Mass | 418.24 |
| IUPAC Name | (1S,5R,9R,11S,13S)-11-acetyloxy-5-(acetyloxymethyl)-5,9-dimethyltetracyclo[11.2.1.01,10.04,9]hexadec-14-ene-14-carboxylic acid |
| SMILES | CC(=O)OC[C@]1(C)CCC[C@]2(C)C1CC[C@]13C=C(C(=O)O)[C@H](CC(OC(C)=O)C12)C3 |
| InChI | InChI=1S/C24H34O6/c1-14(25)29-13-22(3)7-5-8-23(4)19(22)6-9-24-11-16(17(12-24)21(27)28)10-18(20(23)24)30-15(2)26/h12,16,18-20H,5-11,13H2,1-4H3,(H,27,28)/t16-,18?,19?,20?,22+,23-,24+/m1/s1 |
| InChIKey | ONGLJJBMKPIZJW-YOAAQERASA-N |
| XLogP | 4.12 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.53 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |