C25H40O5 — CID 162976243
[(1R,4aS,4bR,7S,9R,10aS)-9-acetyloxy-7-methoxy-1,4a-dimethyl-7-propan-2-yl-3,4,4b,5,6,9,10,10a-octahydro-2H-phenanthren-1-yl]methyl acetate (PubChem CID 162976243) has the molecular formula C25H40O5 and a molecular weight of 420.59 g/mol. Its IUPAC name is [(1R,4aS,4bR,7S,9R,10aS)-9-acetyloxy-7-methoxy-1,4a-dimethyl-7-propan-2-yl-3,4,4b,5,6,9,10,10a-octahydro-2H-phenanthren-1-yl]methyl acetate.
| Compound Name | [(1R,4aS,4bR,7S,9R,10aS)-9-acetyloxy-7-methoxy-1,4a-dimethyl-7-propan-2-yl-3,4,4b,5,6,9,10,10a-octahydro-2H-phenanthren-1-yl]methyl acetate |
|---|---|
| PubChem CID | 162976243 |
| Molecular Formula | C25H40O5 |
| Molecular Weight | 420.59 g/mol |
| Exact Mass | 420.29 |
| IUPAC Name | [(1R,4aS,4bR,7S,9R,10aS)-9-acetyloxy-7-methoxy-1,4a-dimethyl-7-propan-2-yl-3,4,4b,5,6,9,10,10a-octahydro-2H-phenanthren-1-yl]methyl acetate |
| SMILES | CO[C@@]1(C(C)C)C=C2[C@H](OC(C)=O)C[C@@H]3[C@](C)(COC(C)=O)CCC[C@]3(C)[C@H]2CC1 |
| InChI | InChI=1S/C25H40O5/c1-16(2)25(28-7)12-9-20-19(14-25)21(30-18(4)27)13-22-23(5,15-29-17(3)26)10-8-11-24(20,22)6/h14,16,20-22H,8-13,15H2,1-7H3/t20-,21+,22+,23-,24+,25+/m0/s1 |
| InChIKey | AJRWAVGXZFZZSG-JSFAVJLPSA-N |
| XLogP | 5.08 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.59 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|