C25H38O6 — CID 11166427
[(1R,2S,6S,7R,9R,17R)-17-(acetyloxymethyl)-11-methoxy-2,6-dimethyl-10-oxatetracyclo[7.7.1.02,7.013,17]heptadec-13-en-6-yl]methyl acetate (PubChem CID 11166427) has the molecular formula C25H38O6 and a molecular weight of 434.57 g/mol. Its IUPAC name is [(1R,2S,6S,7R,9R,17R)-17-(acetyloxymethyl)-11-methoxy-2,6-dimethyl-10-oxatetracyclo[7.7.1.02,7.013,17]heptadec-13-en-6-yl]methyl acetate.
| Compound Name | [(1R,2S,6S,7R,9R,17R)-17-(acetyloxymethyl)-11-methoxy-2,6-dimethyl-10-oxatetracyclo[7.7.1.02,7.013,17]heptadec-13-en-6-yl]methyl acetate |
|---|---|
| PubChem CID | 11166427 |
| Molecular Formula | C25H38O6 |
| Molecular Weight | 434.57 g/mol |
| Exact Mass | 434.27 |
| IUPAC Name | [(1R,2S,6S,7R,9R,17R)-17-(acetyloxymethyl)-11-methoxy-2,6-dimethyl-10-oxatetracyclo[7.7.1.02,7.013,17]heptadec-13-en-6-yl]methyl acetate |
| SMILES | COC1CC2=CCC[C@@H]3[C@@]4(C)CCC[C@](C)(COC(C)=O)[C@@H]4C[C@@H](O1)[C@@]23COC(C)=O |
| InChI | InChI=1S/C25H38O6/c1-16(26)29-14-23(3)10-7-11-24(4)19-9-6-8-18-12-22(28-5)31-21(13-20(23)24)25(18,19)15-30-17(2)27/h8,19-22H,6-7,9-15H2,1-5H3/t19-,20+,21-,22?,23-,24-,25+/m1/s1 |
| InChIKey | AUBJMTCXKMWLRL-WANGSUJLSA-N |
| XLogP | 4.41 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.57 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|