C25H37NO4 — CID 163124934
2-[7-(acetyloxymethyl)-4b,7,10a-trimethyl-1,5,6,6a,8,9,10,10b,11,12-decahydronaphtho[2,1-f]isoquinolin-2-yl]acetic acid (PubChem CID 163124934) has the molecular formula C25H37NO4 and a molecular weight of 415.57 g/mol. Its IUPAC name is 2-[7-(acetyloxymethyl)-4b,7,10a-trimethyl-1,5,6,6a,8,9,10,10b,11,12-decahydronaphtho[2,1-f]isoquinolin-2-yl]acetic acid.
| Compound Name | 2-[7-(acetyloxymethyl)-4b,7,10a-trimethyl-1,5,6,6a,8,9,10,10b,11,12-decahydronaphtho[2,1-f]isoquinolin-2-yl]acetic acid |
|---|---|
| PubChem CID | 163124934 |
| Molecular Formula | C25H37NO4 |
| Molecular Weight | 415.57 g/mol |
| Exact Mass | 415.27 |
| IUPAC Name | 2-[7-(acetyloxymethyl)-4b,7,10a-trimethyl-1,5,6,6a,8,9,10,10b,11,12-decahydronaphtho[2,1-f]isoquinolin-2-yl]acetic acid |
| SMILES | CC(=O)OCC1(C)CCCC2(C)C1CCC1(C)C3=C(CCC12)CN(CC(=O)O)C=C3 |
| InChI | InChI=1S/C25H37NO4/c1-17(27)30-16-23(2)10-5-11-25(4)20(23)8-12-24(3)19-9-13-26(15-22(28)29)14-18(19)6-7-21(24)25/h9,13,20-21H,5-8,10-12,14-16H2,1-4H3,(H,28,29) |
| InChIKey | CXTSGZSYYDXXBX-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.57 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |