C26H36O4 — CID 132561166
[(5aS,7aR,8S,11aR,11bR,13aS)-8,11a,13a-trimethyl-1-oxo-3,4,5,5a,7,7a,9,10,11,11b,12,13-dodecahydrophenanthro[2,1-e][2]benzofuran-8-yl]methyl acetate (PubChem CID 132561166) has the molecular formula C26H36O4 and a molecular weight of 412.57 g/mol. Its IUPAC name is [(5aS,7aR,8S,11aR,11bR,13aS)-8,11a,13a-trimethyl-1-oxo-3,4,5,5a,7,7a,9,10,11,11b,12,13-dodecahydrophenanthro[2,1-e][2]benzofuran-8-yl]methyl acetate.
| Compound Name | [(5aS,7aR,8S,11aR,11bR,13aS)-8,11a,13a-trimethyl-1-oxo-3,4,5,5a,7,7a,9,10,11,11b,12,13-dodecahydrophenanthro[2,1-e][2]benzofuran-8-yl]methyl acetate |
|---|---|
| PubChem CID | 132561166 |
| Molecular Formula | C26H36O4 |
| Molecular Weight | 412.57 g/mol |
| Exact Mass | 412.26 |
| IUPAC Name | [(5aS,7aR,8S,11aR,11bR,13aS)-8,11a,13a-trimethyl-1-oxo-3,4,5,5a,7,7a,9,10,11,11b,12,13-dodecahydrophenanthro[2,1-e][2]benzofuran-8-yl]methyl acetate |
| SMILES | CC(=O)OC[C@@]1(C)CCC[C@]2(C)[C@H]3CC[C@]4(C)C5=C(CC[C@H]4C3=CC[C@@H]12)COC5=O |
| InChI | InChI=1S/C26H36O4/c1-16(27)30-15-24(2)11-5-12-25(3)20-10-13-26(4)19(18(20)7-9-21(24)25)8-6-17-14-29-23(28)22(17)26/h7,19-21H,5-6,8-15H2,1-4H3/t19-,20-,21-,24+,25+,26-/m0/s1 |
| InChIKey | RYESOEGRPGIGRS-SBBSDALUSA-N |
| XLogP | 5.37 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.57 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|