C24H34O2 — CID 163111214
8,8,11a,13a-tetramethyl-3,4,5,5a,7,7a,9,10,11,11b,12,13-dodecahydrophenanthro[1,2-g][2]benzofuran-1-one (PubChem CID 163111214) has the molecular formula C24H34O2 and a molecular weight of 354.53 g/mol. Its IUPAC name is 8,8,11a,13a-tetramethyl-3,4,5,5a,7,7a,9,10,11,11b,12,13-dodecahydrophenanthro[1,2-g][2]benzofuran-1-one.
| Compound Name | 8,8,11a,13a-tetramethyl-3,4,5,5a,7,7a,9,10,11,11b,12,13-dodecahydrophenanthro[1,2-g][2]benzofuran-1-one |
|---|---|
| PubChem CID | 163111214 |
| Molecular Formula | C24H34O2 |
| Molecular Weight | 354.53 g/mol |
| Exact Mass | 354.26 |
| IUPAC Name | 8,8,11a,13a-tetramethyl-3,4,5,5a,7,7a,9,10,11,11b,12,13-dodecahydrophenanthro[1,2-g][2]benzofuran-1-one |
| SMILES | CC1(C)CCCC2(C)C3CCC4(C)C5=C(CCC4C3=CCC12)COC5=O |
| InChI | InChI=1S/C24H34O2/c1-22(2)11-5-12-23(3)18-10-13-24(4)17(16(18)7-9-19(22)23)8-6-15-14-26-21(25)20(15)24/h7,17-19H,5-6,8-14H2,1-4H3 |
| InChIKey | MMTHWGHPMFCUNV-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.53 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|