C20H30O2 — CID 15867281
(2R,6aS,10aS,10bR)-2-[(E)-but-2-en-2-yl]-7,7,10a-trimethyl-1,2,6,6a,8,9,10,10b-octahydrobenzo[f]isochromen-4-one (PubChem CID 15867281) has the molecular formula C20H30O2 and a molecular weight of 302.46 g/mol. Its IUPAC name is (2R,6aS,10aS,10bR)-2-[(E)-but-2-en-2-yl]-7,7,10a-trimethyl-1,2,6,6a,8,9,10,10b-octahydrobenzo[f]isochromen-4-one.
| Compound Name | (2R,6aS,10aS,10bR)-2-[(E)-but-2-en-2-yl]-7,7,10a-trimethyl-1,2,6,6a,8,9,10,10b-octahydrobenzo[f]isochromen-4-one |
|---|---|
| PubChem CID | 15867281 |
| Molecular Formula | C20H30O2 |
| Molecular Weight | 302.46 g/mol |
| Exact Mass | 302.22 |
| IUPAC Name | (2R,6aS,10aS,10bR)-2-[(E)-but-2-en-2-yl]-7,7,10a-trimethyl-1,2,6,6a,8,9,10,10b-octahydrobenzo[f]isochromen-4-one |
| SMILES | C/C=C(\C)[C@H]1C[C@H]2C(=CC[C@H]3C(C)(C)CCC[C@]23C)C(=O)O1 |
| InChI | InChI=1S/C20H30O2/c1-6-13(2)16-12-15-14(18(21)22-16)8-9-17-19(3,4)10-7-11-20(15,17)5/h6,8,15-17H,7,9-12H2,1-5H3/b13-6+/t15-,16+,17-,20+/m0/s1 |
| InChIKey | ASEBSYWRZMWAJU-SVDHNGHYSA-N |
| XLogP | 5.05 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.46 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|