C20H30O2 — CID 90729045
(4aS,7aS,11aR)-3-but-2-en-2-yl-5,8,8-trimethyl-3,4,4a,7,7a,9,10,11-octahydrobenzo[i]isochromen-1-one (PubChem CID 90729045) has the molecular formula C20H30O2 and a molecular weight of 302.46 g/mol. Its IUPAC name is (4aS,7aS,11aR)-3-but-2-en-2-yl-5,8,8-trimethyl-3,4,4a,7,7a,9,10,11-octahydrobenzo[i]isochromen-1-one.
| Compound Name | (4aS,7aS,11aR)-3-but-2-en-2-yl-5,8,8-trimethyl-3,4,4a,7,7a,9,10,11-octahydrobenzo[i]isochromen-1-one |
|---|---|
| PubChem CID | 90729045 |
| Molecular Formula | C20H30O2 |
| Molecular Weight | 302.46 g/mol |
| Exact Mass | 302.22 |
| IUPAC Name | (4aS,7aS,11aR)-3-but-2-en-2-yl-5,8,8-trimethyl-3,4,4a,7,7a,9,10,11-octahydrobenzo[i]isochromen-1-one |
| SMILES | CC=C(C)C1C[C@H]2C(C)=CC[C@H]3C(C)(C)CCC[C@]23C(=O)O1 |
| InChI | InChI=1S/C20H30O2/c1-6-13(2)16-12-15-14(3)8-9-17-19(4,5)10-7-11-20(15,17)18(21)22-16/h6,8,15-17H,7,9-12H2,1-5H3/t15-,16?,17-,20-/m0/s1 |
| InChIKey | WYVISJVJMINSKW-XHTPDXOGSA-N |
| XLogP | 5.05 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.46 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|