C27H33BrO4 — CID 139199049
[(E)-3-[(2S,6aS,10aS,10bR)-7,7,10a-trimethyl-4-oxo-1,2,6,6a,8,9,10,10b-octahydrobenzo[f]isochromen-2-yl]but-2-enyl] 4-bromobenzoate (PubChem CID 139199049) has the molecular formula C27H33BrO4 and a molecular weight of 501.46 g/mol. Its IUPAC name is [(E)-3-[(2S,6aS,10aS,10bR)-7,7,10a-trimethyl-4-oxo-1,2,6,6a,8,9,10,10b-octahydrobenzo[f]isochromen-2-yl]but-2-enyl] 4-bromobenzoate.
| Compound Name | [(E)-3-[(2S,6aS,10aS,10bR)-7,7,10a-trimethyl-4-oxo-1,2,6,6a,8,9,10,10b-octahydrobenzo[f]isochromen-2-yl]but-2-enyl] 4-bromobenzoate |
|---|---|
| PubChem CID | 139199049 |
| Molecular Formula | C27H33BrO4 |
| Molecular Weight | 501.46 g/mol |
| Exact Mass | 500.16 |
| IUPAC Name | [(E)-3-[(2S,6aS,10aS,10bR)-7,7,10a-trimethyl-4-oxo-1,2,6,6a,8,9,10,10b-octahydrobenzo[f]isochromen-2-yl]but-2-enyl] 4-bromobenzoate |
| SMILES | C/C(=C\COC(=O)c1ccc(Br)cc1)[C@@H]1C[C@H]2C(=CC[C@H]3C(C)(C)CCC[C@]23C)C(=O)O1 |
| InChI | InChI=1S/C27H33BrO4/c1-17(12-15-31-24(29)18-6-8-19(28)9-7-18)22-16-21-20(25(30)32-22)10-11-23-26(2,3)13-5-14-27(21,23)4/h6-10,12,21-23H,5,11,13-16H2,1-4H3/b17-12+/t21-,22-,23-,27+/m0/s1 |
| InChIKey | NWJAXSMKKAJHKC-MVZAZIMSSA-N |
| XLogP | 6.65 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.46 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|