C25H36O3 — CID 155929230
(1R,2S,5R,6R,7S)-5-[(E)-3-[(1R,3aS,7aS)-4,4,7a-trimethyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]but-2-enoxy]-4-oxatricyclo[5.2.1.02,6]dec-8-en-3-one (PubChem CID 155929230) has the molecular formula C25H36O3 and a molecular weight of 384.56 g/mol. Its IUPAC name is (1R,2S,5R,6R,7S)-5-[(E)-3-[(1R,3aS,7aS)-4,4,7a-trimethyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]but-2-enoxy]-4-oxatricyclo[5.2.1.02,6]dec-8-en-3-one.
| Compound Name | (1R,2S,5R,6R,7S)-5-[(E)-3-[(1R,3aS,7aS)-4,4,7a-trimethyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]but-2-enoxy]-4-oxatricyclo[5.2.1.02,6]dec-8-en-3-one |
|---|---|
| PubChem CID | 155929230 |
| Molecular Formula | C25H36O3 |
| Molecular Weight | 384.56 g/mol |
| Exact Mass | 384.27 |
| IUPAC Name | (1R,2S,5R,6R,7S)-5-[(E)-3-[(1R,3aS,7aS)-4,4,7a-trimethyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]but-2-enoxy]-4-oxatricyclo[5.2.1.02,6]dec-8-en-3-one |
| SMILES | C/C(=C\CO[C@@H]1OC(=O)[C@@H]2[C@H]1[C@@H]1C=C[C@H]2C1)[C@H]1CC[C@H]2C(C)(C)CCC[C@]12C |
| InChI | InChI=1S/C25H36O3/c1-15(18-8-9-19-24(2,3)11-5-12-25(18,19)4)10-13-27-23-21-17-7-6-16(14-17)20(21)22(26)28-23/h6-7,10,16-21,23H,5,8-9,11-14H2,1-4H3/b15-10+/t16-,17+,18+,19-,20-,21+,23+,25+/m0/s1 |
| InChIKey | UJTORASMKLUOMZ-NJCDPPKNSA-N |
| XLogP | 5.51 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.56 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|