C20H28O4 — CID 122222272
(1S,2S,4aS,8aR)-5,5,8a-trimethyl-1-[(2E)-2-(2-oxofuran-3-ylidene)ethyl]-1,2,3,4,4a,6,7,8-octahydronaphthalene-2-carboxylic acid (PubChem CID 122222272) has the molecular formula C20H28O4 and a molecular weight of 332.44 g/mol. Its IUPAC name is (1S,2S,4aS,8aR)-5,5,8a-trimethyl-1-[(2E)-2-(2-oxofuran-3-ylidene)ethyl]-1,2,3,4,4a,6,7,8-octahydronaphthalene-2-carboxylic acid.
| Compound Name | (1S,2S,4aS,8aR)-5,5,8a-trimethyl-1-[(2E)-2-(2-oxofuran-3-ylidene)ethyl]-1,2,3,4,4a,6,7,8-octahydronaphthalene-2-carboxylic acid |
|---|---|
| PubChem CID | 122222272 |
| Molecular Formula | C20H28O4 |
| Molecular Weight | 332.44 g/mol |
| Exact Mass | 332.20 |
| IUPAC Name | (1S,2S,4aS,8aR)-5,5,8a-trimethyl-1-[(2E)-2-(2-oxofuran-3-ylidene)ethyl]-1,2,3,4,4a,6,7,8-octahydronaphthalene-2-carboxylic acid |
| SMILES | CC1(C)CCC[C@]2(C)[C@@H](C/C=C3\C=COC3=O)[C@@H](C(=O)O)CC[C@@H]12 |
| InChI | InChI=1S/C20H28O4/c1-19(2)10-4-11-20(3)15(7-5-13-9-12-24-18(13)23)14(17(21)22)6-8-16(19)20/h5,9,12,14-16H,4,6-8,10-11H2,1-3H3,(H,21,22)/b13-5+/t14-,15-,16-,20+/m0/s1 |
| InChIKey | SOHNTUZJRPVINH-JOPOXBGTSA-N |
| XLogP | 4.32 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.44 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'ene_five_het_C(85)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|