C23H32O3 — CID 11256820
(6E)-6-[[(4aS,8aS)-2,5,5,8a-tetramethyl-1,4,4a,6,7,8-hexahydronaphthalen-1-yl]methylidene]-3,4-dimethoxycyclohexa-2,4-dien-1-one (PubChem CID 11256820) has the molecular formula C23H32O3 and a molecular weight of 356.51 g/mol. Its IUPAC name is (6E)-6-[[(4aS,8aS)-2,5,5,8a-tetramethyl-1,4,4a,6,7,8-hexahydronaphthalen-1-yl]methylidene]-3,4-dimethoxycyclohexa-2,4-dien-1-one.
| Compound Name | (6E)-6-[[(4aS,8aS)-2,5,5,8a-tetramethyl-1,4,4a,6,7,8-hexahydronaphthalen-1-yl]methylidene]-3,4-dimethoxycyclohexa-2,4-dien-1-one |
|---|---|
| PubChem CID | 11256820 |
| Molecular Formula | C23H32O3 |
| Molecular Weight | 356.51 g/mol |
| Exact Mass | 356.24 |
| IUPAC Name | (6E)-6-[[(4aS,8aS)-2,5,5,8a-tetramethyl-1,4,4a,6,7,8-hexahydronaphthalen-1-yl]methylidene]-3,4-dimethoxycyclohexa-2,4-dien-1-one |
| SMILES | COC1=CC(=O)/C(=C/C2C(C)=CC[C@H]3C(C)(C)CCC[C@]23C)C=C1OC |
| InChI | InChI=1S/C23H32O3/c1-15-8-9-21-22(2,3)10-7-11-23(21,4)17(15)12-16-13-19(25-5)20(26-6)14-18(16)24/h8,12-14,17,21H,7,9-11H2,1-6H3/b16-12+/t17?,21-,23+/m0/s1 |
| InChIKey | XTGPKOMHDJZSMK-ACEVYWDWSA-N |
| XLogP | 5.35 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.51 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|