C20H32 — CID 10989467
(4aS,4bR)-8-deuterio-7-[(2S)-1-deuteriopropan-2-yl]-1,1,4a-trimethyl-2,3,4,4b,5,6,10,10a-octahydrophenanthrene (PubChem CID 10989467) has the molecular formula C20H32 and a molecular weight of 274.49 g/mol. Its IUPAC name is (4aS,4bR)-8-deuterio-7-[(2S)-1-deuteriopropan-2-yl]-1,1,4a-trimethyl-2,3,4,4b,5,6,10,10a-octahydrophenanthrene.
| Compound Name | (4aS,4bR)-8-deuterio-7-[(2S)-1-deuteriopropan-2-yl]-1,1,4a-trimethyl-2,3,4,4b,5,6,10,10a-octahydrophenanthrene |
|---|---|
| PubChem CID | 10989467 |
| Molecular Formula | C20H32 |
| Molecular Weight | 274.49 g/mol |
| Exact Mass | 274.26 |
| IUPAC Name | (4aS,4bR)-8-deuterio-7-[(2S)-1-deuteriopropan-2-yl]-1,1,4a-trimethyl-2,3,4,4b,5,6,10,10a-octahydrophenanthrene |
| SMILES | [2H]C[C@H](C)C1=C([2H])C2=CCC3C(C)(C)CCC[C@]3(C)[C@H]2CC1 |
| InChI | InChI=1S/C20H32/c1-14(2)15-7-9-17-16(13-15)8-10-18-19(3,4)11-6-12-20(17,18)5/h8,13-14,17-18H,6-7,9-12H2,1-5H3/t17-,18?,20+/m0/s1/i1D,13D/t14-,17+,18?,20-/m1 |
| InChIKey | BBPXZLJCPUPNGH-IUMKMTOTSA-N |
| XLogP | 6.14 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.49 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |