C20H32O — CID 101049010
(4R,4aR,4bS,8aS)-4b,8,8-trimethyl-2-propan-2-yl-3,4,4a,5,6,7,8a,9-octahydrophenanthren-4-ol (PubChem CID 101049010) has the molecular formula C20H32O and a molecular weight of 288.48 g/mol. Its IUPAC name is (4R,4aR,4bS,8aS)-4b,8,8-trimethyl-2-propan-2-yl-3,4,4a,5,6,7,8a,9-octahydrophenanthren-4-ol.
| Compound Name | (4R,4aR,4bS,8aS)-4b,8,8-trimethyl-2-propan-2-yl-3,4,4a,5,6,7,8a,9-octahydrophenanthren-4-ol |
|---|---|
| PubChem CID | 101049010 |
| Molecular Formula | C20H32O |
| Molecular Weight | 288.48 g/mol |
| Exact Mass | 288.25 |
| IUPAC Name | (4R,4aR,4bS,8aS)-4b,8,8-trimethyl-2-propan-2-yl-3,4,4a,5,6,7,8a,9-octahydrophenanthren-4-ol |
| SMILES | CC(C)C1=CC2=CC[C@H]3C(C)(C)CCC[C@]3(C)[C@H]2[C@H](O)C1 |
| InChI | InChI=1S/C20H32O/c1-13(2)15-11-14-7-8-17-19(3,4)9-6-10-20(17,5)18(14)16(21)12-15/h7,11,13,16-18,21H,6,8-10,12H2,1-5H3/t16-,17+,18-,20+/m1/s1 |
| InChIKey | KEEIUTNHRCGXOP-RMJJICAUSA-N |
| XLogP | 5.11 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.48 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |