C20H32 — CID 15109191
(1S,5S,10S,11R,13S,16S)-6,6,10,16-tetramethyltetracyclo[11.2.1.02,11.05,10]hexadec-2-ene (PubChem CID 15109191) has the molecular formula C20H32 and a molecular weight of 272.48 g/mol. Its IUPAC name is (1S,5S,10S,11R,13S,16S)-6,6,10,16-tetramethyltetracyclo[11.2.1.02,11.05,10]hexadec-2-ene.
| Compound Name | (1S,5S,10S,11R,13S,16S)-6,6,10,16-tetramethyltetracyclo[11.2.1.02,11.05,10]hexadec-2-ene |
|---|---|
| PubChem CID | 15109191 |
| Molecular Formula | C20H32 |
| Molecular Weight | 272.48 g/mol |
| Exact Mass | 272.25 |
| IUPAC Name | (1S,5S,10S,11R,13S,16S)-6,6,10,16-tetramethyltetracyclo[11.2.1.02,11.05,10]hexadec-2-ene |
| SMILES | C[C@H]1[C@H]2CC[C@@H]1C1=CC[C@H]3C(C)(C)CCC[C@]3(C)[C@H]1C2 |
| InChI | InChI=1S/C20H32/c1-13-14-6-7-15(13)16-8-9-18-19(2,3)10-5-11-20(18,4)17(16)12-14/h8,13-15,17-18H,5-7,9-12H2,1-4H3/t13-,14-,15-,17-,18-,20+/m0/s1 |
| InChIKey | BUYCKKFBMGQMFN-RUKSUOCASA-N |
| XLogP | 5.83 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.48 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|