C16H26O2 — CID 11994624
(7aS,11aS,11bS)-8,8,11a-trimethyl-1,5,7,7a,9,10,11,11b-octahydrobenzo[g][2,4]benzodioxepine (PubChem CID 11994624) has the molecular formula C16H26O2 and a molecular weight of 250.38 g/mol. Its IUPAC name is (7aS,11aS,11bS)-8,8,11a-trimethyl-1,5,7,7a,9,10,11,11b-octahydrobenzo[g][2,4]benzodioxepine.
| Compound Name | (7aS,11aS,11bS)-8,8,11a-trimethyl-1,5,7,7a,9,10,11,11b-octahydrobenzo[g][2,4]benzodioxepine |
|---|---|
| PubChem CID | 11994624 |
| Molecular Formula | C16H26O2 |
| Molecular Weight | 250.38 g/mol |
| Exact Mass | 250.19 |
| IUPAC Name | (7aS,11aS,11bS)-8,8,11a-trimethyl-1,5,7,7a,9,10,11,11b-octahydrobenzo[g][2,4]benzodioxepine |
| SMILES | CC1(C)CCC[C@]2(C)[C@@H]3COCOCC3=CC[C@@H]12 |
| InChI | InChI=1S/C16H26O2/c1-15(2)7-4-8-16(3)13-10-18-11-17-9-12(13)5-6-14(15)16/h5,13-14H,4,6-11H2,1-3H3/t13-,14+,16-/m1/s1 |
| InChIKey | SCQKMNJMTAKAHK-IJEWVQPXSA-N |
| XLogP | 3.77 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.38 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|