C36H44O5S2 — CID 11387981
[(1R,2S,6S,7R,9R,17R)-17-(acetyloxymethyl)-2,6-dimethyl-11,14-bis(phenylsulfanyl)-10-oxatetracyclo[7.7.1.02,7.013,17]heptadec-13-en-6-yl]methyl acetate (PubChem CID 11387981) has the molecular formula C36H44O5S2 and a molecular weight of 620.88 g/mol. Its IUPAC name is [(1R,2S,6S,7R,9R,17R)-17-(acetyloxymethyl)-2,6-dimethyl-11,14-bis(phenylsulfanyl)-10-oxatetracyclo[7.7.1.02,7.013,17]heptadec-13-en-6-yl]methyl acetate.
| Compound Name | [(1R,2S,6S,7R,9R,17R)-17-(acetyloxymethyl)-2,6-dimethyl-11,14-bis(phenylsulfanyl)-10-oxatetracyclo[7.7.1.02,7.013,17]heptadec-13-en-6-yl]methyl acetate |
|---|---|
| PubChem CID | 11387981 |
| Molecular Formula | C36H44O5S2 |
| Molecular Weight | 620.88 g/mol |
| Exact Mass | 620.26 |
| IUPAC Name | [(1R,2S,6S,7R,9R,17R)-17-(acetyloxymethyl)-2,6-dimethyl-11,14-bis(phenylsulfanyl)-10-oxatetracyclo[7.7.1.02,7.013,17]heptadec-13-en-6-yl]methyl acetate |
| SMILES | CC(=O)OC[C@@]1(C)CCC[C@]2(C)[C@H]3CCC(Sc4ccccc4)=C4CC(Sc5ccccc5)O[C@H](C[C@@H]12)[C@@]43COC(C)=O |
| InChI | InChI=1S/C36H44O5S2/c1-24(37)39-22-34(3)18-11-19-35(4)30-17-16-29(42-26-12-7-5-8-13-26)28-20-33(43-27-14-9-6-10-15-27)41-32(21-31(34)35)36(28,30)23-40-25(2)38/h5-10,12-15,30-33H,11,16-23H2,1-4H3/t30-,31+,32-,33?,34-,35-,36+/m1/s1 |
| InChIKey | WEFDECAECBZIBM-GEVKMSLDSA-N |
| XLogP | 8.68 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.88 |
| LogP ≤ 5 | 8.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |