C38H54O3Si — CID 14264157
[(1R,4aR,4bS,7R,10aR)-7-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-1,4a,7-trimethyl-3,4,4b,5,6,9,10,10a-octahydro-2H-phenanthren-1-yl]methyl acetate (PubChem CID 14264157) has the molecular formula C38H54O3Si and a molecular weight of 586.93 g/mol. Its IUPAC name is [(1R,4aR,4bS,7R,10aR)-7-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-1,4a,7-trimethyl-3,4,4b,5,6,9,10,10a-octahydro-2H-phenanthren-1-yl]methyl acetate.
| Compound Name | [(1R,4aR,4bS,7R,10aR)-7-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-1,4a,7-trimethyl-3,4,4b,5,6,9,10,10a-octahydro-2H-phenanthren-1-yl]methyl acetate |
|---|---|
| PubChem CID | 14264157 |
| Molecular Formula | C38H54O3Si |
| Molecular Weight | 586.93 g/mol |
| Exact Mass | 586.38 |
| IUPAC Name | [(1R,4aR,4bS,7R,10aR)-7-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-1,4a,7-trimethyl-3,4,4b,5,6,9,10,10a-octahydro-2H-phenanthren-1-yl]methyl acetate |
| SMILES | CC(=O)OC[C@]1(C)CCC[C@]2(C)[C@H]3CC[C@](C)(CCO[Si](c4ccccc4)(c4ccccc4)C(C)(C)C)C=C3CC[C@@H]12 |
| InChI | InChI=1S/C38H54O3Si/c1-29(39)40-28-37(6)22-14-23-38(7)33-21-24-36(5,27-30(33)19-20-34(37)38)25-26-41-42(35(2,3)4,31-15-10-8-11-16-31)32-17-12-9-13-18-32/h8-13,15-18,27,33-34H,14,19-26,28H2,1-7H3/t33-,34-,36+,37-,38+/m0/s1 |
| InChIKey | AIHXUKOZMFXIHJ-CHJIGRIRSA-N |
| XLogP | 8.47 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.93 |
| LogP ≤ 5 | 8.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|