C34H48O7Si — CID 23256929
[(4S,6R,8S,10R,13S)-10-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-13-hydroxy-13-methyl-5,7,9-trioxadispiro[5.1.58.26]pentadecan-4-yl]methyl acetate (PubChem CID 23256929) has the molecular formula C34H48O7Si and a molecular weight of 596.84 g/mol. Its IUPAC name is [(4S,6R,8S,10R,13S)-10-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-13-hydroxy-13-methyl-5,7,9-trioxadispiro[5.1.58.26]pentadecan-4-yl]methyl acetate.
| Compound Name | [(4S,6R,8S,10R,13S)-10-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-13-hydroxy-13-methyl-5,7,9-trioxadispiro[5.1.58.26]pentadecan-4-yl]methyl acetate |
|---|---|
| PubChem CID | 23256929 |
| Molecular Formula | C34H48O7Si |
| Molecular Weight | 596.84 g/mol |
| Exact Mass | 596.32 |
| IUPAC Name | [(4S,6R,8S,10R,13S)-10-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-13-hydroxy-13-methyl-5,7,9-trioxadispiro[5.1.58.26]pentadecan-4-yl]methyl acetate |
| SMILES | CC(=O)OC[C@@H]1CCC[C@@]2(CC[C@]3(O[C@@H](CCO[Si](c4ccccc4)(c4ccccc4)C(C)(C)C)CC[C@]3(C)O)O2)O1 |
| InChI | InChI=1S/C34H48O7Si/c1-26(35)37-25-28-13-12-20-33(39-28)22-23-34(41-33)32(5,36)21-18-27(40-34)19-24-38-42(31(2,3)4,29-14-8-6-9-15-29)30-16-10-7-11-17-30/h6-11,14-17,27-28,36H,12-13,18-25H2,1-5H3/t27-,28+,32+,33-,34+/m1/s1 |
| InChIKey | AYEVHZDALWTDLF-ZGBDUXTNSA-N |
| XLogP | 5.22 |
| TPSA | 83.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.84 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|