C31H42O5Si — CID 10815891
[(3R,5S,7S,9S)-9-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-methyl-4,6,8-trioxadispiro[4.1.57.35]pentadec-13-en-3-yl]methanol (PubChem CID 10815891) has the molecular formula C31H42O5Si and a molecular weight of 522.76 g/mol. Its IUPAC name is [(3R,5S,7S,9S)-9-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-methyl-4,6,8-trioxadispiro[4.1.57.35]pentadec-13-en-3-yl]methanol.
| Compound Name | [(3R,5S,7S,9S)-9-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-methyl-4,6,8-trioxadispiro[4.1.57.35]pentadec-13-en-3-yl]methanol |
|---|---|
| PubChem CID | 10815891 |
| Molecular Formula | C31H42O5Si |
| Molecular Weight | 522.76 g/mol |
| Exact Mass | 522.28 |
| IUPAC Name | [(3R,5S,7S,9S)-9-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-methyl-4,6,8-trioxadispiro[4.1.57.35]pentadec-13-en-3-yl]methanol |
| SMILES | CC(C)(C)[Si](OC[C@@H]1CCC[C@]2(C=CC[C@]3(CC[C@](C)(CO)O3)O2)O1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C31H42O5Si/c1-28(2,3)37(26-14-7-5-8-15-26,27-16-9-6-10-17-27)33-23-25-13-11-18-30(34-25)19-12-20-31(36-30)22-21-29(4,24-32)35-31/h5-10,12,14-17,19,25,32H,11,13,18,20-24H2,1-4H3/t25-,29+,30-,31+/m0/s1 |
| InChIKey | XZPSXGKSLISFPH-IQAPJIGKSA-N |
| XLogP | 5.06 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.76 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|