C26H42O6 — CID 4995573
[3-acetyloxy-4-(3-acetyloxy-3-methylpent-4-enyl)-3,4a,8,8-tetramethyl-2,4,5,6,7,8a-hexahydro-1H-naphthalen-1-yl] acetate (PubChem CID 4995573) has the molecular formula C26H42O6 and a molecular weight of 450.62 g/mol. Its IUPAC name is [3-acetyloxy-4-(3-acetyloxy-3-methylpent-4-enyl)-3,4a,8,8-tetramethyl-2,4,5,6,7,8a-hexahydro-1H-naphthalen-1-yl] acetate.
| Compound Name | [3-acetyloxy-4-(3-acetyloxy-3-methylpent-4-enyl)-3,4a,8,8-tetramethyl-2,4,5,6,7,8a-hexahydro-1H-naphthalen-1-yl] acetate |
|---|---|
| PubChem CID | 4995573 |
| Molecular Formula | C26H42O6 |
| Molecular Weight | 450.62 g/mol |
| Exact Mass | 450.30 |
| IUPAC Name | [3-acetyloxy-4-(3-acetyloxy-3-methylpent-4-enyl)-3,4a,8,8-tetramethyl-2,4,5,6,7,8a-hexahydro-1H-naphthalen-1-yl] acetate |
| SMILES | C=CC(C)(CCC1C(C)(OC(C)=O)CC(OC(C)=O)C2C(C)(C)CCCC21C)OC(C)=O |
| InChI | InChI=1S/C26H42O6/c1-10-24(7,31-18(3)28)15-12-21-25(8)14-11-13-23(5,6)22(25)20(30-17(2)27)16-26(21,9)32-19(4)29/h10,20-22H,1,11-16H2,2-9H3 |
| InChIKey | MVDHXJJRAHSUOY-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.62 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|