C22H35IO3 — CID 11733449
[(1R,2R)-2-(3-iodo-4-oxo-3-prop-2-enyloct-7-enyl)-1,3,3-trimethylcyclohexyl] acetate (PubChem CID 11733449) has the molecular formula C22H35IO3 and a molecular weight of 474.42 g/mol. Its IUPAC name is [(1R,2R)-2-(3-iodo-4-oxo-3-prop-2-enyloct-7-enyl)-1,3,3-trimethylcyclohexyl] acetate.
| Compound Name | [(1R,2R)-2-(3-iodo-4-oxo-3-prop-2-enyloct-7-enyl)-1,3,3-trimethylcyclohexyl] acetate |
|---|---|
| PubChem CID | 11733449 |
| Molecular Formula | C22H35IO3 |
| Molecular Weight | 474.42 g/mol |
| Exact Mass | 474.16 |
| IUPAC Name | [(1R,2R)-2-(3-iodo-4-oxo-3-prop-2-enyloct-7-enyl)-1,3,3-trimethylcyclohexyl] acetate |
| SMILES | C=CCCC(=O)C(I)(CC=C)CC[C@@H]1C(C)(C)CCC[C@@]1(C)OC(C)=O |
| InChI | InChI=1S/C22H35IO3/c1-7-9-11-19(25)22(23,13-8-2)16-12-18-20(4,5)14-10-15-21(18,6)26-17(3)24/h7-8,18H,1-2,9-16H2,3-6H3/t18-,21-,22?/m1/s1 |
| InChIKey | YYWWZRJKGDTVHO-QOCBGMSTSA-N |
| XLogP | 6.20 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.42 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|