C14H24O3 — CID 11139240
[(1S,2S)-1,3,3-trimethyl-2-(3-oxobutyl)cyclohexyl] formate (PubChem CID 11139240) has the molecular formula C14H24O3 and a molecular weight of 240.34 g/mol. Its IUPAC name is [(1S,2S)-1,3,3-trimethyl-2-(3-oxobutyl)cyclohexyl] formate.
| Compound Name | [(1S,2S)-1,3,3-trimethyl-2-(3-oxobutyl)cyclohexyl] formate |
|---|---|
| PubChem CID | 11139240 |
| Molecular Formula | C14H24O3 |
| Molecular Weight | 240.34 g/mol |
| Exact Mass | 240.17 |
| IUPAC Name | [(1S,2S)-1,3,3-trimethyl-2-(3-oxobutyl)cyclohexyl] formate |
| SMILES | CC(=O)CC[C@H]1C(C)(C)CCC[C@]1(C)OC=O |
| InChI | InChI=1S/C14H24O3/c1-11(16)6-7-12-13(2,3)8-5-9-14(12,4)17-10-15/h10,12H,5-9H2,1-4H3/t12-,14-/m0/s1 |
| InChIKey | OSFKPMIUJFWIPQ-JSGCOSHPSA-N |
| XLogP | 3.11 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.34 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|