C20H34O3 — CID 73193179
4-hydroxy-4-methyl-1-[1,3,3-trimethyl-2-(3-oxobutyl)cyclohexyl]hex-5-en-1-one (PubChem CID 73193179) has the molecular formula C20H34O3 and a molecular weight of 322.49 g/mol. Its IUPAC name is 4-hydroxy-4-methyl-1-[1,3,3-trimethyl-2-(3-oxobutyl)cyclohexyl]hex-5-en-1-one.
| Compound Name | 4-hydroxy-4-methyl-1-[1,3,3-trimethyl-2-(3-oxobutyl)cyclohexyl]hex-5-en-1-one |
|---|---|
| PubChem CID | 73193179 |
| Molecular Formula | C20H34O3 |
| Molecular Weight | 322.49 g/mol |
| Exact Mass | 322.25 |
| IUPAC Name | 4-hydroxy-4-methyl-1-[1,3,3-trimethyl-2-(3-oxobutyl)cyclohexyl]hex-5-en-1-one |
| SMILES | C=CC(C)(O)CCC(=O)C1(C)CCCC(C)(C)C1CCC(C)=O |
| InChI | InChI=1S/C20H34O3/c1-7-19(5,23)14-11-17(22)20(6)13-8-12-18(3,4)16(20)10-9-15(2)21/h7,16,23H,1,8-14H2,2-6H3 |
| InChIKey | MIBOQXYKXXXWCG-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.49 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|