C22H38O4 — CID 14705358
[(2S,4aS,7R,8R,8aS)-7-hydroxy-8-[(3R)-3-hydroxy-3-methylpent-4-enyl]-4,4,7,8a-tetramethyl-2,3,4a,5,6,8-hexahydro-1H-naphthalen-2-yl] acetate (PubChem CID 14705358) has the molecular formula C22H38O4 and a molecular weight of 366.54 g/mol. Its IUPAC name is [(2S,4aS,7R,8R,8aS)-7-hydroxy-8-[(3R)-3-hydroxy-3-methylpent-4-enyl]-4,4,7,8a-tetramethyl-2,3,4a,5,6,8-hexahydro-1H-naphthalen-2-yl] acetate.
| Compound Name | [(2S,4aS,7R,8R,8aS)-7-hydroxy-8-[(3R)-3-hydroxy-3-methylpent-4-enyl]-4,4,7,8a-tetramethyl-2,3,4a,5,6,8-hexahydro-1H-naphthalen-2-yl] acetate |
|---|---|
| PubChem CID | 14705358 |
| Molecular Formula | C22H38O4 |
| Molecular Weight | 366.54 g/mol |
| Exact Mass | 366.28 |
| IUPAC Name | [(2S,4aS,7R,8R,8aS)-7-hydroxy-8-[(3R)-3-hydroxy-3-methylpent-4-enyl]-4,4,7,8a-tetramethyl-2,3,4a,5,6,8-hexahydro-1H-naphthalen-2-yl] acetate |
| SMILES | C=C[C@](C)(O)CC[C@@H]1[C@@]2(C)C[C@@H](OC(C)=O)CC(C)(C)[C@@H]2CC[C@@]1(C)O |
| InChI | InChI=1S/C22H38O4/c1-8-20(5,24)11-9-18-21(6)14-16(26-15(2)23)13-19(3,4)17(21)10-12-22(18,7)25/h8,16-18,24-25H,1,9-14H2,2-7H3/t16-,17-,18+,20-,21-,22+/m0/s1 |
| InChIKey | ZUMOXPZXPUBNIO-QITMKZSESA-N |
| XLogP | 4.24 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.54 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|