C17H32O2 — CID 155460534
(2R)-1-(2-hydroxyethyl)-2,5,5,7,8a-pentamethyl-3,4,4a,6,7,8-hexahydro-1H-naphthalen-2-ol (PubChem CID 155460534) has the molecular formula C17H32O2 and a molecular weight of 268.44 g/mol. Its IUPAC name is (2R)-1-(2-hydroxyethyl)-2,5,5,7,8a-pentamethyl-3,4,4a,6,7,8-hexahydro-1H-naphthalen-2-ol.
| Compound Name | (2R)-1-(2-hydroxyethyl)-2,5,5,7,8a-pentamethyl-3,4,4a,6,7,8-hexahydro-1H-naphthalen-2-ol |
|---|---|
| PubChem CID | 155460534 |
| Molecular Formula | C17H32O2 |
| Molecular Weight | 268.44 g/mol |
| Exact Mass | 268.24 |
| IUPAC Name | (2R)-1-(2-hydroxyethyl)-2,5,5,7,8a-pentamethyl-3,4,4a,6,7,8-hexahydro-1H-naphthalen-2-ol |
| SMILES | CC1CC(C)(C)C2CC[C@@](C)(O)C(CCO)C2(C)C1 |
| InChI | InChI=1S/C17H32O2/c1-12-10-15(2,3)13-6-8-17(5,19)14(7-9-18)16(13,4)11-12/h12-14,18-19H,6-11H2,1-5H3/t12?,13?,14?,16?,17-/m1/s1 |
| InChIKey | XNLTTZURRCPTLP-BQAHKBOESA-N |
| XLogP | 3.61 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.44 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |