C16H29FO — CID 129213657
2-[(1R,2R,8aS)-2-fluoro-2,5,5,8a-tetramethyl-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl]ethanol (PubChem CID 129213657) has the molecular formula C16H29FO and a molecular weight of 256.40 g/mol. Its IUPAC name is 2-[(1R,2R,8aS)-2-fluoro-2,5,5,8a-tetramethyl-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl]ethanol.
| Compound Name | 2-[(1R,2R,8aS)-2-fluoro-2,5,5,8a-tetramethyl-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl]ethanol |
|---|---|
| PubChem CID | 129213657 |
| Molecular Formula | C16H29FO |
| Molecular Weight | 256.40 g/mol |
| Exact Mass | 256.22 |
| IUPAC Name | 2-[(1R,2R,8aS)-2-fluoro-2,5,5,8a-tetramethyl-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl]ethanol |
| SMILES | CC1(C)CCC[C@@]2(C)C1CC[C@@](C)(F)[C@@H]2CCO |
| InChI | InChI=1S/C16H29FO/c1-14(2)8-5-9-15(3)12(14)6-10-16(4,17)13(15)7-11-18/h12-13,18H,5-11H2,1-4H3/t12?,13-,15+,16-/m1/s1 |
| InChIKey | OBOSAEKKFNGCAP-BHUMPYGKSA-N |
| XLogP | 4.34 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.40 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |