C16H30O3 — CID 101113600
(1S,3R,4R,4aS)-4-(2-hydroxyethyl)-3,4a,8,8-tetramethyl-2,4,5,6,7,8a-hexahydro-1H-naphthalene-1,3-diol (PubChem CID 101113600) has the molecular formula C16H30O3 and a molecular weight of 270.41 g/mol. Its IUPAC name is (1S,3R,4R,4aS)-4-(2-hydroxyethyl)-3,4a,8,8-tetramethyl-2,4,5,6,7,8a-hexahydro-1H-naphthalene-1,3-diol.
| Compound Name | (1S,3R,4R,4aS)-4-(2-hydroxyethyl)-3,4a,8,8-tetramethyl-2,4,5,6,7,8a-hexahydro-1H-naphthalene-1,3-diol |
|---|---|
| PubChem CID | 101113600 |
| Molecular Formula | C16H30O3 |
| Molecular Weight | 270.41 g/mol |
| Exact Mass | 270.22 |
| IUPAC Name | (1S,3R,4R,4aS)-4-(2-hydroxyethyl)-3,4a,8,8-tetramethyl-2,4,5,6,7,8a-hexahydro-1H-naphthalene-1,3-diol |
| SMILES | CC1(C)CCC[C@@]2(C)C1[C@@H](O)C[C@@](C)(O)[C@@H]2CCO |
| InChI | InChI=1S/C16H30O3/c1-14(2)7-5-8-15(3)12(6-9-17)16(4,19)10-11(18)13(14)15/h11-13,17-19H,5-10H2,1-4H3/t11-,12+,13?,15+,16+/m0/s1 |
| InChIKey | YEOHKJHQEOQNOQ-YUOTWFEZSA-N |
| XLogP | 2.33 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.41 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |