C20H38O3 — CID 163011849
(1R,3R,4R,4aS,8aS)-4-[(3S)-5-hydroxy-3-methylpentyl]-3,4a,8,8-tetramethyl-2,4,5,6,7,8a-hexahydro-1H-naphthalene-1,3-diol (PubChem CID 163011849) has the molecular formula C20H38O3 and a molecular weight of 326.52 g/mol. Its IUPAC name is (1R,3R,4R,4aS,8aS)-4-[(3S)-5-hydroxy-3-methylpentyl]-3,4a,8,8-tetramethyl-2,4,5,6,7,8a-hexahydro-1H-naphthalene-1,3-diol.
| Compound Name | (1R,3R,4R,4aS,8aS)-4-[(3S)-5-hydroxy-3-methylpentyl]-3,4a,8,8-tetramethyl-2,4,5,6,7,8a-hexahydro-1H-naphthalene-1,3-diol |
|---|---|
| PubChem CID | 163011849 |
| Molecular Formula | C20H38O3 |
| Molecular Weight | 326.52 g/mol |
| Exact Mass | 326.28 |
| IUPAC Name | (1R,3R,4R,4aS,8aS)-4-[(3S)-5-hydroxy-3-methylpentyl]-3,4a,8,8-tetramethyl-2,4,5,6,7,8a-hexahydro-1H-naphthalene-1,3-diol |
| SMILES | C[C@H](CCO)CC[C@@H]1[C@@]2(C)CCCC(C)(C)[C@@H]2[C@H](O)C[C@@]1(C)O |
| InChI | InChI=1S/C20H38O3/c1-14(9-12-21)7-8-16-19(4)11-6-10-18(2,3)17(19)15(22)13-20(16,5)23/h14-17,21-23H,6-13H2,1-5H3/t14-,15+,16+,17-,19+,20+/m0/s1 |
| InChIKey | QSMLNKZXKOEDHG-KUIXFMFUSA-N |
| XLogP | 3.75 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.52 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |