C17H30O2 — CID 144526385
(4aS,8aS,10R)-1,1,4a-trimethyl-3,4,4b,5,6,7,8,9,10,10a-decahydro-2H-phenanthrene-8a,10-diol (PubChem CID 144526385) has the molecular formula C17H30O2 and a molecular weight of 266.42 g/mol. Its IUPAC name is (4aS,8aS,10R)-1,1,4a-trimethyl-3,4,4b,5,6,7,8,9,10,10a-decahydro-2H-phenanthrene-8a,10-diol.
| Compound Name | (4aS,8aS,10R)-1,1,4a-trimethyl-3,4,4b,5,6,7,8,9,10,10a-decahydro-2H-phenanthrene-8a,10-diol |
|---|---|
| PubChem CID | 144526385 |
| Molecular Formula | C17H30O2 |
| Molecular Weight | 266.42 g/mol |
| Exact Mass | 266.22 |
| IUPAC Name | (4aS,8aS,10R)-1,1,4a-trimethyl-3,4,4b,5,6,7,8,9,10,10a-decahydro-2H-phenanthrene-8a,10-diol |
| SMILES | CC1(C)CCC[C@@]2(C)C1[C@H](O)C[C@@]1(O)CCCCC12 |
| InChI | InChI=1S/C17H30O2/c1-15(2)8-6-9-16(3)13-7-4-5-10-17(13,19)11-12(18)14(15)16/h12-14,18-19H,4-11H2,1-3H3/t12-,13?,14?,16-,17+/m1/s1 |
| InChIKey | FLKBBTIAAHGMJS-HVOIHPLZSA-N |
| XLogP | 3.50 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.42 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |