C20H36O2 — CID 66743546
(4aR,4bR,8aS,10aR)-4b,8,8-trimethyl-10a-propan-2-yl-2,3,4,4a,5,6,7,8a,9,10-decahydro-1H-phenanthrene-9,10-diol (PubChem CID 66743546) has the molecular formula C20H36O2 and a molecular weight of 308.51 g/mol. Its IUPAC name is (4aR,4bR,8aS,10aR)-4b,8,8-trimethyl-10a-propan-2-yl-2,3,4,4a,5,6,7,8a,9,10-decahydro-1H-phenanthrene-9,10-diol.
| Compound Name | (4aR,4bR,8aS,10aR)-4b,8,8-trimethyl-10a-propan-2-yl-2,3,4,4a,5,6,7,8a,9,10-decahydro-1H-phenanthrene-9,10-diol |
|---|---|
| PubChem CID | 66743546 |
| Molecular Formula | C20H36O2 |
| Molecular Weight | 308.51 g/mol |
| Exact Mass | 308.27 |
| IUPAC Name | (4aR,4bR,8aS,10aR)-4b,8,8-trimethyl-10a-propan-2-yl-2,3,4,4a,5,6,7,8a,9,10-decahydro-1H-phenanthrene-9,10-diol |
| SMILES | CC(C)[C@]12CCCC[C@@H]1[C@@]1(C)CCCC(C)(C)[C@@H]1C(O)C2O |
| InChI | InChI=1S/C20H36O2/c1-13(2)20-12-7-6-9-14(20)19(5)11-8-10-18(3,4)16(19)15(21)17(20)22/h13-17,21-22H,6-12H2,1-5H3/t14-,15?,16+,17?,19-,20-/m1/s1 |
| InChIKey | XNIBCNHWDNADMX-ITYIOMLNSA-N |
| XLogP | 4.39 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.51 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |