C20H36O5 — CID 129427212
(1R,2R,3S,4S,4aS,8aS)-4-[(2R,3S)-2,3-dihydroxy-3-methylpent-4-enyl]-3,4a,8,8-tetramethyl-2,4,5,6,7,8a-hexahydro-1H-naphthalene-1,2,3-triol (PubChem CID 129427212) has the molecular formula C20H36O5 and a molecular weight of 356.50 g/mol. Its IUPAC name is (1R,2R,3S,4S,4aS,8aS)-4-[(2R,3S)-2,3-dihydroxy-3-methylpent-4-enyl]-3,4a,8,8-tetramethyl-2,4,5,6,7,8a-hexahydro-1H-naphthalene-1,2,3-triol.
| Compound Name | (1R,2R,3S,4S,4aS,8aS)-4-[(2R,3S)-2,3-dihydroxy-3-methylpent-4-enyl]-3,4a,8,8-tetramethyl-2,4,5,6,7,8a-hexahydro-1H-naphthalene-1,2,3-triol |
|---|---|
| PubChem CID | 129427212 |
| Molecular Formula | C20H36O5 |
| Molecular Weight | 356.50 g/mol |
| Exact Mass | 356.26 |
| IUPAC Name | (1R,2R,3S,4S,4aS,8aS)-4-[(2R,3S)-2,3-dihydroxy-3-methylpent-4-enyl]-3,4a,8,8-tetramethyl-2,4,5,6,7,8a-hexahydro-1H-naphthalene-1,2,3-triol |
| SMILES | C=C[C@](C)(O)[C@H](O)C[C@@H]1[C@](C)(O)[C@H](O)[C@H](O)[C@H]2C(C)(C)CCC[C@]12C |
| InChI | InChI=1S/C20H36O5/c1-7-19(5,24)13(21)11-12-18(4)10-8-9-17(2,3)15(18)14(22)16(23)20(12,6)25/h7,12-16,21-25H,1,8-11H2,2-6H3/t12-,13+,14+,15-,16+,18+,19-,20-/m0/s1 |
| InChIKey | WQGJQTTYXPLSSA-KENULNKJSA-N |
| XLogP | 1.61 |
| TPSA | 101.15 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.50 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|