C23H38O3 — CID 102588555
(3aR,4R,5S,5aR,9aR,9bS)-2,2,4,5a,9,9-hexamethyl-5-[(2E)-3-methylpenta-2,4-dienyl]-5,6,7,8,9a,9b-hexahydro-3aH-naphtho[1,2-d][1,3]dioxol-4-ol (PubChem CID 102588555) has the molecular formula C23H38O3 and a molecular weight of 362.55 g/mol. Its IUPAC name is (3aR,4R,5S,5aR,9aR,9bS)-2,2,4,5a,9,9-hexamethyl-5-[(2E)-3-methylpenta-2,4-dienyl]-5,6,7,8,9a,9b-hexahydro-3aH-naphtho[1,2-d][1,3]dioxol-4-ol.
| Compound Name | (3aR,4R,5S,5aR,9aR,9bS)-2,2,4,5a,9,9-hexamethyl-5-[(2E)-3-methylpenta-2,4-dienyl]-5,6,7,8,9a,9b-hexahydro-3aH-naphtho[1,2-d][1,3]dioxol-4-ol |
|---|---|
| PubChem CID | 102588555 |
| Molecular Formula | C23H38O3 |
| Molecular Weight | 362.55 g/mol |
| Exact Mass | 362.28 |
| IUPAC Name | (3aR,4R,5S,5aR,9aR,9bS)-2,2,4,5a,9,9-hexamethyl-5-[(2E)-3-methylpenta-2,4-dienyl]-5,6,7,8,9a,9b-hexahydro-3aH-naphtho[1,2-d][1,3]dioxol-4-ol |
| SMILES | C=C/C(C)=C/C[C@@H]1[C@@](C)(O)[C@@H]2OC(C)(C)O[C@H]2[C@@H]2C(C)(C)CCC[C@]21C |
| InChI | InChI=1S/C23H38O3/c1-9-15(2)11-12-16-22(7)14-10-13-20(3,4)18(22)17-19(23(16,8)24)26-21(5,6)25-17/h9,11,16-19,24H,1,10,12-14H2,2-8H3/b15-11+/t16-,17-,18+,19+,22-,23+/m0/s1 |
| InChIKey | UKAWDTYXZVAWRD-OXOGUAQRSA-N |
| XLogP | 5.24 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.55 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|