C20H34O4 — CID 129427191
(2S,3aS,4R,5S,5aS,9aR,9bR)-2-[(2S)-2-hydroxybut-3-en-2-yl]-3a,6,6,9a-tetramethyl-2,4,5,5a,7,8,9,9b-octahydro-1H-benzo[e][1]benzofuran-4,5-diol (PubChem CID 129427191) has the molecular formula C20H34O4 and a molecular weight of 338.49 g/mol. Its IUPAC name is (2S,3aS,4R,5S,5aS,9aR,9bR)-2-[(2S)-2-hydroxybut-3-en-2-yl]-3a,6,6,9a-tetramethyl-2,4,5,5a,7,8,9,9b-octahydro-1H-benzo[e][1]benzofuran-4,5-diol.
| Compound Name | (2S,3aS,4R,5S,5aS,9aR,9bR)-2-[(2S)-2-hydroxybut-3-en-2-yl]-3a,6,6,9a-tetramethyl-2,4,5,5a,7,8,9,9b-octahydro-1H-benzo[e][1]benzofuran-4,5-diol |
|---|---|
| PubChem CID | 129427191 |
| Molecular Formula | C20H34O4 |
| Molecular Weight | 338.49 g/mol |
| Exact Mass | 338.25 |
| IUPAC Name | (2S,3aS,4R,5S,5aS,9aR,9bR)-2-[(2S)-2-hydroxybut-3-en-2-yl]-3a,6,6,9a-tetramethyl-2,4,5,5a,7,8,9,9b-octahydro-1H-benzo[e][1]benzofuran-4,5-diol |
| SMILES | C=C[C@](C)(O)[C@@H]1C[C@@H]2[C@]3(C)CCCC(C)(C)[C@@H]3[C@H](O)[C@@H](O)[C@@]2(C)O1 |
| InChI | InChI=1S/C20H34O4/c1-7-19(5,23)13-11-12-18(4)10-8-9-17(2,3)15(18)14(21)16(22)20(12,6)24-13/h7,12-16,21-23H,1,8-11H2,2-6H3/t12-,13+,14+,15+,16-,18+,19+,20+/m1/s1 |
| InChIKey | UNORIIWPFZFSEC-OEYLYHFRSA-N |
| XLogP | 2.66 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.49 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|