C20H34O4 — CID 11473219
(1R,2S,3S,4R,4aS)-4-[(1E,3S)-3-hydroxy-3-methylpenta-1,4-dienyl]-3,4a,8,8-tetramethyl-2,4,5,6,7,8a-hexahydro-1H-naphthalene-1,2,3-triol (PubChem CID 11473219) has the molecular formula C20H34O4 and a molecular weight of 338.49 g/mol. Its IUPAC name is (1R,2S,3S,4R,4aS)-4-[(1E,3S)-3-hydroxy-3-methylpenta-1,4-dienyl]-3,4a,8,8-tetramethyl-2,4,5,6,7,8a-hexahydro-1H-naphthalene-1,2,3-triol.
| Compound Name | (1R,2S,3S,4R,4aS)-4-[(1E,3S)-3-hydroxy-3-methylpenta-1,4-dienyl]-3,4a,8,8-tetramethyl-2,4,5,6,7,8a-hexahydro-1H-naphthalene-1,2,3-triol |
|---|---|
| PubChem CID | 11473219 |
| Molecular Formula | C20H34O4 |
| Molecular Weight | 338.49 g/mol |
| Exact Mass | 338.25 |
| IUPAC Name | (1R,2S,3S,4R,4aS)-4-[(1E,3S)-3-hydroxy-3-methylpenta-1,4-dienyl]-3,4a,8,8-tetramethyl-2,4,5,6,7,8a-hexahydro-1H-naphthalene-1,2,3-triol |
| SMILES | C=C[C@](C)(O)/C=C/[C@H]1[C@](C)(O)[C@@H](O)[C@H](O)C2C(C)(C)CCC[C@@]21C |
| InChI | InChI=1S/C20H34O4/c1-7-18(4,23)12-9-13-19(5)11-8-10-17(2,3)15(19)14(21)16(22)20(13,6)24/h7,9,12-16,21-24H,1,8,10-11H2,2-6H3/b12-9+/t13-,14-,15?,16+,18+,19-,20+/m1/s1 |
| InChIKey | MHBIPUOMMSRZKQ-BMNXOGLLSA-N |
| XLogP | 2.41 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.49 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|