C20H34O2 — CID 134815158
(4aS,4bR,7S,8aS,10R)-7-ethenyl-1,1,4a,7-tetramethyl-2,3,4,4b,5,6,8,9,10,10a-decahydrophenanthrene-8a,10-diol (PubChem CID 134815158) has the molecular formula C20H34O2 and a molecular weight of 306.49 g/mol. Its IUPAC name is (4aS,4bR,7S,8aS,10R)-7-ethenyl-1,1,4a,7-tetramethyl-2,3,4,4b,5,6,8,9,10,10a-decahydrophenanthrene-8a,10-diol.
| Compound Name | (4aS,4bR,7S,8aS,10R)-7-ethenyl-1,1,4a,7-tetramethyl-2,3,4,4b,5,6,8,9,10,10a-decahydrophenanthrene-8a,10-diol |
|---|---|
| PubChem CID | 134815158 |
| Molecular Formula | C20H34O2 |
| Molecular Weight | 306.49 g/mol |
| Exact Mass | 306.26 |
| IUPAC Name | (4aS,4bR,7S,8aS,10R)-7-ethenyl-1,1,4a,7-tetramethyl-2,3,4,4b,5,6,8,9,10,10a-decahydrophenanthrene-8a,10-diol |
| SMILES | C=C[C@@]1(C)CC[C@H]2[C@@](O)(C[C@@H](O)C3C(C)(C)CCC[C@@]32C)C1 |
| InChI | InChI=1S/C20H34O2/c1-6-18(4)11-8-15-19(5)10-7-9-17(2,3)16(19)14(21)12-20(15,22)13-18/h6,14-16,21-22H,1,7-13H2,2-5H3/t14-,15-,16?,18+,19-,20-/m1/s1 |
| InChIKey | DTBXEYNZFLTFJY-IPGAMOKNSA-N |
| XLogP | 4.31 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.49 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|