C23H36O7 — CID 102217379
dimethyl 2-[2-[(1R,2R,4S,4aS,8aS)-2-acetyloxy-4-hydroxy-2,5,5,8a-tetramethyl-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl]ethylidene]propanedioate (PubChem CID 102217379) has the molecular formula C23H36O7 and a molecular weight of 424.53 g/mol. Its IUPAC name is dimethyl 2-[2-[(1R,2R,4S,4aS,8aS)-2-acetyloxy-4-hydroxy-2,5,5,8a-tetramethyl-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl]ethylidene]propanedioate.
| Compound Name | dimethyl 2-[2-[(1R,2R,4S,4aS,8aS)-2-acetyloxy-4-hydroxy-2,5,5,8a-tetramethyl-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl]ethylidene]propanedioate |
|---|---|
| PubChem CID | 102217379 |
| Molecular Formula | C23H36O7 |
| Molecular Weight | 424.53 g/mol |
| Exact Mass | 424.25 |
| IUPAC Name | dimethyl 2-[2-[(1R,2R,4S,4aS,8aS)-2-acetyloxy-4-hydroxy-2,5,5,8a-tetramethyl-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl]ethylidene]propanedioate |
| SMILES | COC(=O)C(=CC[C@@H]1[C@@]2(C)CCCC(C)(C)[C@@H]2[C@@H](O)C[C@@]1(C)OC(C)=O)C(=O)OC |
| InChI | InChI=1S/C23H36O7/c1-14(24)30-23(5)13-16(25)18-21(2,3)11-8-12-22(18,4)17(23)10-9-15(19(26)28-6)20(27)29-7/h9,16-18,25H,8,10-13H2,1-7H3/t16-,17+,18-,22+,23+/m0/s1 |
| InChIKey | KMOFDYAWJJTEKR-BRZWXCIUSA-N |
| XLogP | 3.18 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.53 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|