C21H34O4 — CID 123534338
dimethyl 2-[2-(5,5,8a-trimethyl-1,2,3,4,4a,6,7,8-octahydronaphthalen-1-yl)ethylidene]butanedioate (PubChem CID 123534338) has the molecular formula C21H34O4 and a molecular weight of 350.50 g/mol. Its IUPAC name is dimethyl 2-[2-(5,5,8a-trimethyl-1,2,3,4,4a,6,7,8-octahydronaphthalen-1-yl)ethylidene]butanedioate.
| Compound Name | dimethyl 2-[2-(5,5,8a-trimethyl-1,2,3,4,4a,6,7,8-octahydronaphthalen-1-yl)ethylidene]butanedioate |
|---|---|
| PubChem CID | 123534338 |
| Molecular Formula | C21H34O4 |
| Molecular Weight | 350.50 g/mol |
| Exact Mass | 350.25 |
| IUPAC Name | dimethyl 2-[2-(5,5,8a-trimethyl-1,2,3,4,4a,6,7,8-octahydronaphthalen-1-yl)ethylidene]butanedioate |
| SMILES | COC(=O)CC(=CCC1CCCC2C(C)(C)CCCC12C)C(=O)OC |
| InChI | InChI=1S/C21H34O4/c1-20(2)12-7-13-21(3)16(8-6-9-17(20)21)11-10-15(19(23)25-5)14-18(22)24-4/h10,16-17H,6-9,11-14H2,1-5H3 |
| InChIKey | SSMDEWBQPBDJRX-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.50 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|