C25H40O5 — CID 162883779
[6-acetyloxy-1-(hydroxymethyl)-1b,4,4,7a,9a-pentamethyl-1a,2,3,3a,5,6,7,7b,8,9-decahydro-1H-cyclopropa[a]phenanthren-9-yl] acetate (PubChem CID 162883779) has the molecular formula C25H40O5 and a molecular weight of 420.59 g/mol. Its IUPAC name is [6-acetyloxy-1-(hydroxymethyl)-1b,4,4,7a,9a-pentamethyl-1a,2,3,3a,5,6,7,7b,8,9-decahydro-1H-cyclopropa[a]phenanthren-9-yl] acetate.
| Compound Name | [6-acetyloxy-1-(hydroxymethyl)-1b,4,4,7a,9a-pentamethyl-1a,2,3,3a,5,6,7,7b,8,9-decahydro-1H-cyclopropa[a]phenanthren-9-yl] acetate |
|---|---|
| PubChem CID | 162883779 |
| Molecular Formula | C25H40O5 |
| Molecular Weight | 420.59 g/mol |
| Exact Mass | 420.29 |
| IUPAC Name | [6-acetyloxy-1-(hydroxymethyl)-1b,4,4,7a,9a-pentamethyl-1a,2,3,3a,5,6,7,7b,8,9-decahydro-1H-cyclopropa[a]phenanthren-9-yl] acetate |
| SMILES | CC(=O)OC1CC(C)(C)C2CCC3(C)C(CC(OC(C)=O)C4(C)C(CO)C34)C2(C)C1 |
| InChI | InChI=1S/C25H40O5/c1-14(27)29-16-11-22(3,4)18-8-9-23(5)19(24(18,6)12-16)10-20(30-15(2)28)25(7)17(13-26)21(23)25/h16-21,26H,8-13H2,1-7H3 |
| InChIKey | FPQQEIMHYJQCSQ-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.59 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |