C28H42O8 — CID 4138497
(2,6,16-triacetyloxy-5,9,13-trimethyl-5-tetracyclo[11.2.1.01,10.04,9]hexadecanyl)methyl acetate (PubChem CID 4138497) has the molecular formula C28H42O8 and a molecular weight of 506.64 g/mol. Its IUPAC name is (2,6,16-triacetyloxy-5,9,13-trimethyl-5-tetracyclo[11.2.1.01,10.04,9]hexadecanyl)methyl acetate.
| Compound Name | (2,6,16-triacetyloxy-5,9,13-trimethyl-5-tetracyclo[11.2.1.01,10.04,9]hexadecanyl)methyl acetate |
|---|---|
| PubChem CID | 4138497 |
| Molecular Formula | C28H42O8 |
| Molecular Weight | 506.64 g/mol |
| Exact Mass | 506.29 |
| IUPAC Name | (2,6,16-triacetyloxy-5,9,13-trimethyl-5-tetracyclo[11.2.1.01,10.04,9]hexadecanyl)methyl acetate |
| SMILES | CC(=O)OCC1(C)C(OC(C)=O)CCC2(C)C1CC(OC(C)=O)C13CCC(C)(CCC21)C3OC(C)=O |
| InChI | InChI=1S/C28H42O8/c1-16(29)33-15-27(7)21-14-23(35-18(3)31)28-13-12-25(5,24(28)36-19(4)32)10-8-20(28)26(21,6)11-9-22(27)34-17(2)30/h20-24H,8-15H2,1-7H3 |
| InChIKey | RUGDLCGDAHEZNT-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.64 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|