C26H38O6 — CID 5216820
(2,6-diacetyloxy-5,9,14-trimethyl-5-tetracyclo[11.2.1.01,10.04,9]hexadec-14-enyl)methyl acetate (PubChem CID 5216820) has the molecular formula C26H38O6 and a molecular weight of 446.58 g/mol. Its IUPAC name is (2,6-diacetyloxy-5,9,14-trimethyl-5-tetracyclo[11.2.1.01,10.04,9]hexadec-14-enyl)methyl acetate.
| Compound Name | (2,6-diacetyloxy-5,9,14-trimethyl-5-tetracyclo[11.2.1.01,10.04,9]hexadec-14-enyl)methyl acetate |
|---|---|
| PubChem CID | 5216820 |
| Molecular Formula | C26H38O6 |
| Molecular Weight | 446.58 g/mol |
| Exact Mass | 446.27 |
| IUPAC Name | (2,6-diacetyloxy-5,9,14-trimethyl-5-tetracyclo[11.2.1.01,10.04,9]hexadec-14-enyl)methyl acetate |
| SMILES | CC(=O)OCC1(C)C(OC(C)=O)CCC2(C)C1CC(OC(C)=O)C13C=C(C)C(CCC21)C3 |
| InChI | InChI=1S/C26H38O6/c1-15-12-26-13-19(15)7-8-20(26)24(5)10-9-22(31-17(3)28)25(6,14-30-16(2)27)21(24)11-23(26)32-18(4)29/h12,19-23H,7-11,13-14H2,1-6H3 |
| InChIKey | ZBKKRIKPUBNSTL-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.58 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|