C30H46O7 — CID 163114121
(8-acetyl-9-acetylperoxy-7-formyl-1,1,4a,6a,10b-pentamethyl-2,3,4,4b,5,6,7,8,9,10,10a,11,12,12a-tetradecahydrochrysen-6-yl) acetate (PubChem CID 163114121) has the molecular formula C30H46O7 and a molecular weight of 518.69 g/mol. Its IUPAC name is (8-acetyl-9-acetylperoxy-7-formyl-1,1,4a,6a,10b-pentamethyl-2,3,4,4b,5,6,7,8,9,10,10a,11,12,12a-tetradecahydrochrysen-6-yl) acetate.
| Compound Name | (8-acetyl-9-acetylperoxy-7-formyl-1,1,4a,6a,10b-pentamethyl-2,3,4,4b,5,6,7,8,9,10,10a,11,12,12a-tetradecahydrochrysen-6-yl) acetate |
|---|---|
| PubChem CID | 163114121 |
| Molecular Formula | C30H46O7 |
| Molecular Weight | 518.69 g/mol |
| Exact Mass | 518.32 |
| IUPAC Name | (8-acetyl-9-acetylperoxy-7-formyl-1,1,4a,6a,10b-pentamethyl-2,3,4,4b,5,6,7,8,9,10,10a,11,12,12a-tetradecahydrochrysen-6-yl) acetate |
| SMILES | CC(=O)OOC1CC2C3(C)CCC4C(C)(C)CCCC4(C)C3CC(OC(C)=O)C2(C)C(C=O)C1C(C)=O |
| InChI | InChI=1S/C30H46O7/c1-17(32)26-20(16-31)30(8)24(14-21(26)37-36-19(3)34)29(7)13-10-22-27(4,5)11-9-12-28(22,6)23(29)15-25(30)35-18(2)33/h16,20-26H,9-15H2,1-8H3 |
| InChIKey | URSGLXUHWJPRFU-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.69 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|