C30H44O6 — CID 163111152
(8-acetyl-6-acetyloxy-7-formyl-1,1,6a,10b-tetramethyl-2,3,4,4b,5,6,7,10,10a,11,12,12a-dodecahydrochrysen-4a-yl)methyl acetate (PubChem CID 163111152) has the molecular formula C30H44O6 and a molecular weight of 500.68 g/mol. Its IUPAC name is (8-acetyl-6-acetyloxy-7-formyl-1,1,6a,10b-tetramethyl-2,3,4,4b,5,6,7,10,10a,11,12,12a-dodecahydrochrysen-4a-yl)methyl acetate.
| Compound Name | (8-acetyl-6-acetyloxy-7-formyl-1,1,6a,10b-tetramethyl-2,3,4,4b,5,6,7,10,10a,11,12,12a-dodecahydrochrysen-4a-yl)methyl acetate |
|---|---|
| PubChem CID | 163111152 |
| Molecular Formula | C30H44O6 |
| Molecular Weight | 500.68 g/mol |
| Exact Mass | 500.31 |
| IUPAC Name | (8-acetyl-6-acetyloxy-7-formyl-1,1,6a,10b-tetramethyl-2,3,4,4b,5,6,7,10,10a,11,12,12a-dodecahydrochrysen-4a-yl)methyl acetate |
| SMILES | CC(=O)OCC12CCCC(C)(C)C1CCC1(C)C2CC(OC(C)=O)C2(C)C(C=O)C(C(C)=O)=CCC12 |
| InChI | InChI=1S/C30H44O6/c1-18(32)21-9-10-24-28(6)14-11-23-27(4,5)12-8-13-30(23,17-35-19(2)33)25(28)15-26(36-20(3)34)29(24,7)22(21)16-31/h9,16,22-26H,8,10-15,17H2,1-7H3 |
| InChIKey | MILGTNLDZPYOKW-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.68 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|