C28H40O5 — CID 5231784
(8-acetyl-7-formyl-1,1,6a,10b-tetramethyl-6-oxo-3,4,4b,5,7,10,10a,11,12,12a-decahydro-2H-chrysen-4a-yl)methyl acetate (PubChem CID 5231784) has the molecular formula C28H40O5 and a molecular weight of 456.62 g/mol. Its IUPAC name is (8-acetyl-7-formyl-1,1,6a,10b-tetramethyl-6-oxo-3,4,4b,5,7,10,10a,11,12,12a-decahydro-2H-chrysen-4a-yl)methyl acetate.
| Compound Name | (8-acetyl-7-formyl-1,1,6a,10b-tetramethyl-6-oxo-3,4,4b,5,7,10,10a,11,12,12a-decahydro-2H-chrysen-4a-yl)methyl acetate |
|---|---|
| PubChem CID | 5231784 |
| Molecular Formula | C28H40O5 |
| Molecular Weight | 456.62 g/mol |
| Exact Mass | 456.29 |
| IUPAC Name | (8-acetyl-7-formyl-1,1,6a,10b-tetramethyl-6-oxo-3,4,4b,5,7,10,10a,11,12,12a-decahydro-2H-chrysen-4a-yl)methyl acetate |
| SMILES | CC(=O)OCC12CCCC(C)(C)C1CCC1(C)C2CC(=O)C2(C)C(C=O)C(C(C)=O)=CCC12 |
| InChI | InChI=1S/C28H40O5/c1-17(30)19-8-9-22-26(5)13-10-21-25(3,4)11-7-12-28(21,16-33-18(2)31)23(26)14-24(32)27(22,6)20(19)15-29/h8,15,20-23H,7,9-14,16H2,1-6H3 |
| InChIKey | AAKXYHDCCGNXGU-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.62 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|