C19H38O2 — CID 170570898
[(1R,2R,8aS)-1-ethyl-2,5,5,8a-tetramethyl-3,4,4a,6,7,8-hexahydro-1H-naphthalen-2-yl] formate;ethane;molecular hydrogen (PubChem CID 170570898) has the molecular formula C19H38O2 and a molecular weight of 298.51 g/mol. Its IUPAC name is [(1R,2R,8aS)-1-ethyl-2,5,5,8a-tetramethyl-3,4,4a,6,7,8-hexahydro-1H-naphthalen-2-yl] formate;ethane;molecular hydrogen.
| Compound Name | [(1R,2R,8aS)-1-ethyl-2,5,5,8a-tetramethyl-3,4,4a,6,7,8-hexahydro-1H-naphthalen-2-yl] formate;ethane;molecular hydrogen |
|---|---|
| PubChem CID | 170570898 |
| Molecular Formula | C19H38O2 |
| Molecular Weight | 298.51 g/mol |
| Exact Mass | 298.29 |
| IUPAC Name | [(1R,2R,8aS)-1-ethyl-2,5,5,8a-tetramethyl-3,4,4a,6,7,8-hexahydro-1H-naphthalen-2-yl] formate;ethane;molecular hydrogen |
| SMILES | CC.CC[C@H]1[C@](C)(OC=O)CCC2C(C)(C)CCC[C@@]21C.[H][H] |
| InChI | InChI=1S/C17H30O2.C2H6.H2/c1-6-13-16(4)10-7-9-15(2,3)14(16)8-11-17(13,5)19-12-18;1-2;/h12-14H,6-11H2,1-5H3;1-2H3;1H/t13-,14?,16-,17-;;/m1../s1 |
| InChIKey | TZNUHZQHCLBAJG-XHAGEIICSA-N |
| XLogP | 5.84 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.51 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|