C34H37NO2S2 — CID 102478409
5-[5-[5-(5,5-dimethyl-1,3-dioxan-2-yl)thiophen-2-yl]thiophen-2-yl]-2-(4-hexylphenyl)-1H-indole (PubChem CID 102478409) has the molecular formula C34H37NO2S2 and a molecular weight of 555.81 g/mol. Its IUPAC name is 5-[5-[5-(5,5-dimethyl-1,3-dioxan-2-yl)thiophen-2-yl]thiophen-2-yl]-2-(4-hexylphenyl)-1H-indole.
| Compound Name | 5-[5-[5-(5,5-dimethyl-1,3-dioxan-2-yl)thiophen-2-yl]thiophen-2-yl]-2-(4-hexylphenyl)-1H-indole |
|---|---|
| PubChem CID | 102478409 |
| Molecular Formula | C34H37NO2S2 |
| Molecular Weight | 555.81 g/mol |
| Exact Mass | 555.23 |
| IUPAC Name | 5-[5-[5-(5,5-dimethyl-1,3-dioxan-2-yl)thiophen-2-yl]thiophen-2-yl]-2-(4-hexylphenyl)-1H-indole |
| SMILES | CCCCCCc1ccc(-c2cc3cc(-c4ccc(-c5ccc(C6OCC(C)(C)CO6)s5)s4)ccc3[nH]2)cc1 |
| InChI | InChI=1S/C34H37NO2S2/c1-4-5-6-7-8-23-9-11-24(12-10-23)28-20-26-19-25(13-14-27(26)35-28)29-15-16-30(38-29)31-17-18-32(39-31)33-36-21-34(2,3)22-37-33/h9-20,33,35H,4-8,21-22H2,1-3H3 |
| InChIKey | MBKBQQDVVJHUKS-UHFFFAOYSA-N |
| XLogP | 10.49 |
| TPSA | 34.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.81 |
| LogP ≤ 5 | 10.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|