C16H16N2O9 — CID 102479289
3-hydroxy-N-[2-[2-[(3-hydroxy-4-oxopyran-2-carbonyl)amino]ethoxy]ethyl]-4-oxopyran-2-carboxamide (PubChem CID 102479289) has the molecular formula C16H16N2O9 and a molecular weight of 380.31 g/mol. Its IUPAC name is 3-hydroxy-N-[2-[2-[(3-hydroxy-4-oxopyran-2-carbonyl)amino]ethoxy]ethyl]-4-oxopyran-2-carboxamide.
| Compound Name | 3-hydroxy-N-[2-[2-[(3-hydroxy-4-oxopyran-2-carbonyl)amino]ethoxy]ethyl]-4-oxopyran-2-carboxamide |
|---|---|
| PubChem CID | 102479289 |
| Molecular Formula | C16H16N2O9 |
| Molecular Weight | 380.31 g/mol |
| Exact Mass | 380.09 |
| IUPAC Name | 3-hydroxy-N-[2-[2-[(3-hydroxy-4-oxopyran-2-carbonyl)amino]ethoxy]ethyl]-4-oxopyran-2-carboxamide |
| SMILES | O=C(NCCOCCNC(=O)c1occc(=O)c1O)c1occc(=O)c1O |
| InChI | InChI=1S/C16H16N2O9/c19-9-1-5-26-13(11(9)21)15(23)17-3-7-25-8-4-18-16(24)14-12(22)10(20)2-6-27-14/h1-2,5-6,21-22H,3-4,7-8H2,(H,17,23)(H,18,24) |
| InChIKey | IRWNNOBKVUBCSC-UHFFFAOYSA-N |
| XLogP | -0.82 |
| TPSA | 168.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.31 |
| LogP ≤ 5 | -0.82 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|