C19H26N2O — CID 102479308
N-[1-(1-oxidopyridin-1-ium-2-yl)ethyl]-2,6-di(propan-2-yl)aniline (PubChem CID 102479308) has the molecular formula C19H26N2O and a molecular weight of 298.43 g/mol. Its IUPAC name is N-[1-(1-oxidopyridin-1-ium-2-yl)ethyl]-2,6-di(propan-2-yl)aniline.
| Compound Name | N-[1-(1-oxidopyridin-1-ium-2-yl)ethyl]-2,6-di(propan-2-yl)aniline |
|---|---|
| PubChem CID | 102479308 |
| Molecular Formula | C19H26N2O |
| Molecular Weight | 298.43 g/mol |
| Exact Mass | 298.20 |
| IUPAC Name | N-[1-(1-oxidopyridin-1-ium-2-yl)ethyl]-2,6-di(propan-2-yl)aniline |
| SMILES | CC(C)c1cccc(C(C)C)c1NC(C)c1cccc[n+]1[O-] |
| InChI | InChI=1S/C19H26N2O/c1-13(2)16-9-8-10-17(14(3)4)19(16)20-15(5)18-11-6-7-12-21(18)22/h6-15,20H,1-5H3 |
| InChIKey | UVIPMSVALOWIMZ-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 38.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.43 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|